C13H11ClN2O4 — CID 106685995
N-[4-(2-amino-2-oxoethoxy)phenyl]-2-chlorofuran-3-carboxamide (PubChem CID 106685995) has the molecular formula C13H11ClN2O4 and a molecular weight of 294.69 g/mol. Its IUPAC name is N-[4-(2-amino-2-oxoethoxy)phenyl]-2-chlorofuran-3-carboxamide.
| Compound Name | N-[4-(2-amino-2-oxoethoxy)phenyl]-2-chlorofuran-3-carboxamide |
|---|---|
| PubChem CID | 106685995 |
| Molecular Formula | C13H11ClN2O4 |
| Molecular Weight | 294.69 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | N-[4-(2-amino-2-oxoethoxy)phenyl]-2-chlorofuran-3-carboxamide |
| SMILES | NC(=O)COc1ccc(NC(=O)c2ccoc2Cl)cc1 |
| InChI | InChI=1S/C13H11ClN2O4/c14-12-10(5-6-19-12)13(18)16-8-1-3-9(4-2-8)20-7-11(15)17/h1-6H,7H2,(H2,15,17)(H,16,18) |
| InChIKey | QDLYHAOWYYLISF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.69 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |