C22H17N3O3 — CID 71894350
N-[4-(2-amino-2-oxoethoxy)phenyl]benzo[f]quinoline-5-carboxamide (PubChem CID 71894350) has the molecular formula C22H17N3O3 and a molecular weight of 371.40 g/mol. Its IUPAC name is N-[4-(2-amino-2-oxoethoxy)phenyl]benzo[f]quinoline-5-carboxamide.
| Compound Name | N-[4-(2-amino-2-oxoethoxy)phenyl]benzo[f]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 71894350 |
| Molecular Formula | C22H17N3O3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-[4-(2-amino-2-oxoethoxy)phenyl]benzo[f]quinoline-5-carboxamide |
| SMILES | NC(=O)COc1ccc(NC(=O)c2cc3ccccc3c3cccnc23)cc1 |
| InChI | InChI=1S/C22H17N3O3/c23-20(26)13-28-16-9-7-15(8-10-16)25-22(27)19-12-14-4-1-2-5-17(14)18-6-3-11-24-21(18)19/h1-12H,13H2,(H2,23,26)(H,25,27) |
| InChIKey | RPJUBWMVJDLHDM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|