C12H18N4O4Si — CID 140776896
4-oxo-1-(2-trimethylsilylethoxymethyl)-5H-pyrazolo[5,4-d]pyrimidine-3-carboxylic acid (PubChem CID 140776896) has the molecular formula C12H18N4O4Si and a molecular weight of 310.39 g/mol. Its IUPAC name is 4-oxo-1-(2-trimethylsilylethoxymethyl)-5H-pyrazolo[5,4-d]pyrimidine-3-carboxylic acid.
| Compound Name | 4-oxo-1-(2-trimethylsilylethoxymethyl)-5H-pyrazolo[5,4-d]pyrimidine-3-carboxylic acid |
|---|---|
| PubChem CID | 140776896 |
| Molecular Formula | C12H18N4O4Si |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 4-oxo-1-(2-trimethylsilylethoxymethyl)-5H-pyrazolo[5,4-d]pyrimidine-3-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCn1nc(C(=O)O)c2c(=O)[nH]cnc21 |
| InChI | InChI=1S/C12H18N4O4Si/c1-21(2,3)5-4-20-7-16-10-8(9(15-16)12(18)19)11(17)14-6-13-10/h6H,4-5,7H2,1-3H3,(H,18,19)(H,13,14,17) |
| InChIKey | KDQLGFZYYZEKJQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|