C13H18N4O2Si — CID 171465845
5-hydroxy-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridine-3-carbonitrile (PubChem CID 171465845) has the molecular formula C13H18N4O2Si and a molecular weight of 290.40 g/mol. Its IUPAC name is 5-hydroxy-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridine-3-carbonitrile.
| Compound Name | 5-hydroxy-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 171465845 |
| Molecular Formula | C13H18N4O2Si |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 5-hydroxy-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridine-3-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1nc(C#N)c2cc(O)cnc21 |
| InChI | InChI=1S/C13H18N4O2Si/c1-20(2,3)5-4-19-9-17-13-11(12(7-14)16-17)6-10(18)8-15-13/h6,8,18H,4-5,9H2,1-3H3 |
| InChIKey | QZNZGXYHFAHODB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|