C18H26N4O3Si — CID 168825139
4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridine-3-carbonitrile (PubChem CID 168825139) has the molecular formula C18H26N4O3Si and a molecular weight of 374.52 g/mol. Its IUPAC name is 4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridine-3-carbonitrile.
| Compound Name | 4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 168825139 |
| Molecular Formula | C18H26N4O3Si |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridine-3-carbonitrile |
| SMILES | CC1(C)OCC(c2ccnc3c2c(C#N)nn3COCC[Si](C)(C)C)O1 |
| InChI | InChI=1S/C18H26N4O3Si/c1-18(2)24-11-15(25-18)13-6-7-20-17-16(13)14(10-19)21-22(17)12-23-8-9-26(3,4)5/h6-7,15H,8-9,11-12H2,1-5H3 |
| InChIKey | CFKNYRVSGQZZCN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 82.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|