C14H20BrN3O2Si — CID 171465871
2-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridin-3-yl]acetaldehyde (PubChem CID 171465871) has the molecular formula C14H20BrN3O2Si and a molecular weight of 370.32 g/mol. Its IUPAC name is 2-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridin-3-yl]acetaldehyde.
| Compound Name | 2-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridin-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 171465871 |
| Molecular Formula | C14H20BrN3O2Si |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 2-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridin-3-yl]acetaldehyde |
| SMILES | C[Si](C)(C)CCOCn1nc(CC=O)c2cc(Br)cnc21 |
| InChI | InChI=1S/C14H20BrN3O2Si/c1-21(2,3)7-6-20-10-18-14-12(8-11(15)9-16-14)13(17-18)4-5-19/h5,8-9H,4,6-7,10H2,1-3H3 |
| InChIKey | KZBAEIJAJDLXNP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|