C17H23BrN4OSi — CID 174083889
2-[[5-bromo-2-(2-methylpyrazol-3-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 174083889) has the molecular formula C17H23BrN4OSi and a molecular weight of 407.39 g/mol. Its IUPAC name is 2-[[5-bromo-2-(2-methylpyrazol-3-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-bromo-2-(2-methylpyrazol-3-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 174083889 |
| Molecular Formula | C17H23BrN4OSi |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 2-[[5-bromo-2-(2-methylpyrazol-3-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cn1nccc1-c1cc2cc(Br)cnc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C17H23BrN4OSi/c1-21-15(5-6-20-21)16-10-13-9-14(18)11-19-17(13)22(16)12-23-7-8-24(2,3)4/h5-6,9-11H,7-8,12H2,1-4H3 |
| InChIKey | ASWQGVYXKJVTMX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|