C22H32N4O2Si — CID 175929447
3-[2-(2-methylpyrazol-3-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]cyclopentan-1-ol (PubChem CID 175929447) has the molecular formula C22H32N4O2Si and a molecular weight of 412.61 g/mol. Its IUPAC name is 3-[2-(2-methylpyrazol-3-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]cyclopentan-1-ol.
| Compound Name | 3-[2-(2-methylpyrazol-3-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 175929447 |
| Molecular Formula | C22H32N4O2Si |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 3-[2-(2-methylpyrazol-3-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]cyclopentan-1-ol |
| SMILES | Cn1nccc1-c1cc2cc(C3CCC(O)C3)cnc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C22H32N4O2Si/c1-25-20(7-8-24-25)21-13-17-11-18(16-5-6-19(27)12-16)14-23-22(17)26(21)15-28-9-10-29(2,3)4/h7-8,11,13-14,16,19,27H,5-6,9-10,12,15H2,1-4H3 |
| InChIKey | JTOYQPUPFUOPRC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|