C18H28N2O3Si — CID 176724184
2-[(4-cyclopropyl-2,7-dimethoxypyrrolo[2,3-c]pyridin-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 176724184) has the molecular formula C18H28N2O3Si and a molecular weight of 348.52 g/mol. Its IUPAC name is 2-[(4-cyclopropyl-2,7-dimethoxypyrrolo[2,3-c]pyridin-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(4-cyclopropyl-2,7-dimethoxypyrrolo[2,3-c]pyridin-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 176724184 |
| Molecular Formula | C18H28N2O3Si |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 2-[(4-cyclopropyl-2,7-dimethoxypyrrolo[2,3-c]pyridin-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | COc1ncc(C2CC2)c2cc(OC)n(COCC[Si](C)(C)C)c12 |
| InChI | InChI=1S/C18H28N2O3Si/c1-21-16-10-14-15(13-6-7-13)11-19-18(22-2)17(14)20(16)12-23-8-9-24(3,4)5/h10-11,13H,6-9,12H2,1-5H3 |
| InChIKey | FQRRRRSYTSGXAN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|