C22H35N3O3Si — CID 176724206
4-cyclopropyl-2-[[[(1S,2R)-2-hydroxycyclopentyl]amino]methyl]-1-(2-trimethylsilylethoxymethyl)-6H-pyrrolo[2,3-c]pyridin-7-one (PubChem CID 176724206) has the molecular formula C22H35N3O3Si and a molecular weight of 417.63 g/mol. Its IUPAC name is 4-cyclopropyl-2-[[[(1S,2R)-2-hydroxycyclopentyl]amino]methyl]-1-(2-trimethylsilylethoxymethyl)-6H-pyrrolo[2,3-c]pyridin-7-one.
| Compound Name | 4-cyclopropyl-2-[[[(1S,2R)-2-hydroxycyclopentyl]amino]methyl]-1-(2-trimethylsilylethoxymethyl)-6H-pyrrolo[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 176724206 |
| Molecular Formula | C22H35N3O3Si |
| Molecular Weight | 417.63 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 4-cyclopropyl-2-[[[(1S,2R)-2-hydroxycyclopentyl]amino]methyl]-1-(2-trimethylsilylethoxymethyl)-6H-pyrrolo[2,3-c]pyridin-7-one |
| SMILES | C[Si](C)(C)CCOCn1c(CN[C@H]2CCC[C@H]2O)cc2c(C3CC3)c[nH]c(=O)c21 |
| InChI | InChI=1S/C22H35N3O3Si/c1-29(2,3)10-9-28-14-25-16(12-23-19-5-4-6-20(19)26)11-17-18(15-7-8-15)13-24-22(27)21(17)25/h11,13,15,19-20,23,26H,4-10,12,14H2,1-3H3,(H,24,27)/t19-,20+/m0/s1 |
| InChIKey | DFPRAHOHMGIISC-VQTJNVASSA-N |
| XLogP | 3.52 |
| TPSA | 79.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.63 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|