C22H31N3O2Si — CID 172801143
1-cyclohexyl-2-(2-trimethylsilylethoxymethyl)-7H-pyrrolo[2,3-h][1,6]naphthyridin-4-one (PubChem CID 172801143) has the molecular formula C22H31N3O2Si and a molecular weight of 397.60 g/mol. Its IUPAC name is 1-cyclohexyl-2-(2-trimethylsilylethoxymethyl)-7H-pyrrolo[2,3-h][1,6]naphthyridin-4-one.
| Compound Name | 1-cyclohexyl-2-(2-trimethylsilylethoxymethyl)-7H-pyrrolo[2,3-h][1,6]naphthyridin-4-one |
|---|---|
| PubChem CID | 172801143 |
| Molecular Formula | C22H31N3O2Si |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 1-cyclohexyl-2-(2-trimethylsilylethoxymethyl)-7H-pyrrolo[2,3-h][1,6]naphthyridin-4-one |
| SMILES | C[Si](C)(C)CCOCc1cc(=O)c2cnc3[nH]ccc3c2n1C1CCCCC1 |
| InChI | InChI=1S/C22H31N3O2Si/c1-28(2,3)12-11-27-15-17-13-20(26)19-14-24-22-18(9-10-23-22)21(19)25(17)16-7-5-4-6-8-16/h9-10,13-14,16H,4-8,11-12,15H2,1-3H3,(H,23,24) |
| InChIKey | QWMDPSNUFDUKBN-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|