C17H19N3O — CID 118524161
1-(4-methylcyclohexyl)-7H-pyrrolo[2,3-h][1,6]naphthyridin-4-one (PubChem CID 118524161) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-(4-methylcyclohexyl)-7H-pyrrolo[2,3-h][1,6]naphthyridin-4-one.
| Compound Name | 1-(4-methylcyclohexyl)-7H-pyrrolo[2,3-h][1,6]naphthyridin-4-one |
|---|---|
| PubChem CID | 118524161 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 1-(4-methylcyclohexyl)-7H-pyrrolo[2,3-h][1,6]naphthyridin-4-one |
| SMILES | CC1CCC(n2ccc(=O)c3cnc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C17H19N3O/c1-11-2-4-12(5-3-11)20-9-7-15(21)14-10-19-17-13(16(14)20)6-8-18-17/h6-12H,2-5H2,1H3,(H,18,19) |
| InChIKey | DJDZRWASZKDCAW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |