C15H18N4O2 — CID 59292049
3-(2-methoxycyclohexyl)-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-5-one (PubChem CID 59292049) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is 3-(2-methoxycyclohexyl)-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-5-one.
| Compound Name | 3-(2-methoxycyclohexyl)-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-5-one |
|---|---|
| PubChem CID | 59292049 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 3-(2-methoxycyclohexyl)-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-5-one |
| SMILES | COC1CCCCC1n1[nH]c(=O)c2cnc3[nH]ccc3c21 |
| InChI | InChI=1S/C15H18N4O2/c1-21-12-5-3-2-4-11(12)19-13-9-6-7-16-14(9)17-8-10(13)15(20)18-19/h6-8,11-12H,2-5H2,1H3,(H,16,17)(H,18,20) |
| InChIKey | OGFHPUWOMSZAJG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 75.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |