C17H22N4O — CID 58395538
3-cyclohexyl-4-[(1R)-1-methoxyethyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene (PubChem CID 58395538) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is 3-cyclohexyl-4-[(1R)-1-methoxyethyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene.
| Compound Name | 3-cyclohexyl-4-[(1R)-1-methoxyethyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
|---|---|
| PubChem CID | 58395538 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 3-cyclohexyl-4-[(1R)-1-methoxyethyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
| SMILES | CO[C@H](C)c1nc2cnc3[nH]ccc3c2n1C1CCCCC1 |
| InChI | InChI=1S/C17H22N4O/c1-11(22-2)17-20-14-10-19-16-13(8-9-18-16)15(14)21(17)12-6-4-3-5-7-12/h8-12H,3-7H2,1-2H3,(H,18,19)/t11-/m1/s1 |
| InChIKey | SNYLTJJDCNAWIB-LLVKDONJSA-N |
| XLogP | 4.13 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |