C15H19N5O — CID 71229984
(1R)-1-[3-[(2S)-2-aminocyclopentyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol (PubChem CID 71229984) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is (1R)-1-[3-[(2S)-2-aminocyclopentyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol.
| Compound Name | (1R)-1-[3-[(2S)-2-aminocyclopentyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol |
|---|---|
| PubChem CID | 71229984 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | (1R)-1-[3-[(2S)-2-aminocyclopentyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol |
| SMILES | C[C@@H](O)c1nc2cnc3[nH]ccc3c2n1C1CCC[C@@H]1N |
| InChI | InChI=1S/C15H19N5O/c1-8(21)15-19-11-7-18-14-9(5-6-17-14)13(11)20(15)12-4-2-3-10(12)16/h5-8,10,12,21H,2-4,16H2,1H3,(H,17,18)/t8-,10+,12?/m1/s1 |
| InChIKey | MUPPFWKWPZORON-RWPGAEDHSA-N |
| XLogP | 2.02 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |