C22H22F3N5OS — CID 88929918
1-[3-[1-[[6-(trifluoromethyl)thiopyran-3-yl]methyl]piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol (PubChem CID 88929918) has the molecular formula C22H22F3N5OS and a molecular weight of 461.51 g/mol. Its IUPAC name is 1-[3-[1-[[6-(trifluoromethyl)thiopyran-3-yl]methyl]piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol.
| Compound Name | 1-[3-[1-[[6-(trifluoromethyl)thiopyran-3-yl]methyl]piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol |
|---|---|
| PubChem CID | 88929918 |
| Molecular Formula | C22H22F3N5OS |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 1-[3-[1-[[6-(trifluoromethyl)thiopyran-3-yl]methyl]piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol |
| SMILES | CC(O)c1nc2cnc3[nH]ccc3c2n1C1CCN(CC2=CSC(C(F)(F)F)=C=C2)CC1 |
| InChI | InChI=1S/C22H22F3N5OS/c1-13(31)21-28-17-10-27-20-16(4-7-26-20)19(17)30(21)15-5-8-29(9-6-15)11-14-2-3-18(32-12-14)22(23,24)25/h2,4,7,10,12-13,15,31H,5-6,8-9,11H2,1H3,(H,26,27) |
| InChIKey | HLTUZYHNJFOLLA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |