C19H22N6O — CID 71229527
(1R)-1-[3-(4-imidazol-1-ylcyclohexyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol (PubChem CID 71229527) has the molecular formula C19H22N6O and a molecular weight of 350.43 g/mol. Its IUPAC name is (1R)-1-[3-(4-imidazol-1-ylcyclohexyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol.
| Compound Name | (1R)-1-[3-(4-imidazol-1-ylcyclohexyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol |
|---|---|
| PubChem CID | 71229527 |
| Molecular Formula | C19H22N6O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | (1R)-1-[3-(4-imidazol-1-ylcyclohexyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol |
| SMILES | C[C@@H](O)c1nc2cnc3[nH]ccc3c2n1C1CCC(n2ccnc2)CC1 |
| InChI | InChI=1S/C19H22N6O/c1-12(26)19-23-16-10-22-18-15(6-7-21-18)17(16)25(19)14-4-2-13(3-5-14)24-9-8-20-11-24/h6-14,26H,2-5H2,1H3,(H,21,22)/t12-,13?,14?/m1/s1 |
| InChIKey | SMNUOBLQMSQKFJ-IYXRBSQSSA-N |
| XLogP | 3.52 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |