C23H27N5 — CID 58395153
3-(1-benzylpiperidin-4-yl)-4-propan-2-yl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene (PubChem CID 58395153) has the molecular formula C23H27N5 and a molecular weight of 373.50 g/mol. Its IUPAC name is 3-(1-benzylpiperidin-4-yl)-4-propan-2-yl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene.
| Compound Name | 3-(1-benzylpiperidin-4-yl)-4-propan-2-yl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
|---|---|
| PubChem CID | 58395153 |
| Molecular Formula | C23H27N5 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | 3-(1-benzylpiperidin-4-yl)-4-propan-2-yl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
| SMILES | CC(C)c1nc2cnc3[nH]ccc3c2n1C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H27N5/c1-16(2)23-26-20-14-25-22-19(8-11-24-22)21(20)28(23)18-9-12-27(13-10-18)15-17-6-4-3-5-7-17/h3-8,11,14,16,18H,9-10,12-13,15H2,1-2H3,(H,24,25) |
| InChIKey | OAYWYSGMBWODHK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |