C22H24N4 — CID 66726458
3-[(3S,4S)-1-benzyl-4-methylpiperidin-3-yl]-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene (PubChem CID 66726458) has the molecular formula C22H24N4 and a molecular weight of 344.46 g/mol. Its IUPAC name is 3-[(3S,4S)-1-benzyl-4-methylpiperidin-3-yl]-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene.
| Compound Name | 3-[(3S,4S)-1-benzyl-4-methylpiperidin-3-yl]-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
|---|---|
| PubChem CID | 66726458 |
| Molecular Formula | C22H24N4 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 3-[(3S,4S)-1-benzyl-4-methylpiperidin-3-yl]-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
| SMILES | C[C@H]1CCN(Cc2ccccc2)C[C@H]1n1ccc2cnc3[nH]ccc3c21 |
| InChI | InChI=1S/C22H24N4/c1-16-8-11-25(14-17-5-3-2-4-6-17)15-20(16)26-12-9-18-13-24-22-19(21(18)26)7-10-23-22/h2-7,9-10,12-13,16,20H,8,11,14-15H2,1H3,(H,23,24)/t16-,20+/m0/s1 |
| InChIKey | XATQTEUQMQVLFJ-OXJNMPFZSA-N |
| XLogP | 4.60 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |