C30H33N5O2 — CID 58078746
12-[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]-5-[(3,4-dimethoxyphenyl)methyl]-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,10-pentaene (PubChem CID 58078746) has the molecular formula C30H33N5O2 and a molecular weight of 495.63 g/mol. Its IUPAC name is 12-[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]-5-[(3,4-dimethoxyphenyl)methyl]-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,10-pentaene.
| Compound Name | 12-[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]-5-[(3,4-dimethoxyphenyl)methyl]-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,10-pentaene |
|---|---|
| PubChem CID | 58078746 |
| Molecular Formula | C30H33N5O2 |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | 12-[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]-5-[(3,4-dimethoxyphenyl)methyl]-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,10-pentaene |
| SMILES | COc1ccc(Cn2cnc3c2ncc2ccn([C@H]4CN(Cc5ccccc5)CC[C@H]4C)c23)cc1OC |
| InChI | InChI=1S/C30H33N5O2/c1-21-11-13-33(17-22-7-5-4-6-8-22)19-25(21)35-14-12-24-16-31-30-28(29(24)35)32-20-34(30)18-23-9-10-26(36-2)27(15-23)37-3/h4-10,12,14-16,20-21,25H,11,13,17-19H2,1-3H3/t21-,25+/m1/s1 |
| InChIKey | LRCMSPGROLCDML-BWKNWUBXSA-N |
| XLogP | 5.53 |
| TPSA | 57.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |