C29H32N6O3 — CID 59291992
12-[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]-5-[(3,4-dimethoxyphenyl)methyl]-3,5,7,10,12-pentazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraen-11-one (PubChem CID 59291992) has the molecular formula C29H32N6O3 and a molecular weight of 512.61 g/mol. Its IUPAC name is 12-[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]-5-[(3,4-dimethoxyphenyl)methyl]-3,5,7,10,12-pentazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraen-11-one.
| Compound Name | 12-[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]-5-[(3,4-dimethoxyphenyl)methyl]-3,5,7,10,12-pentazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraen-11-one |
|---|---|
| PubChem CID | 59291992 |
| Molecular Formula | C29H32N6O3 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | 12-[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]-5-[(3,4-dimethoxyphenyl)methyl]-3,5,7,10,12-pentazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraen-11-one |
| SMILES | COc1ccc(Cn2cnc3c2ncc2[nH]c(=O)n([C@H]4CN(Cc5ccccc5)CC[C@H]4C)c23)cc1OC |
| InChI | InChI=1S/C29H32N6O3/c1-19-11-12-33(15-20-7-5-4-6-8-20)17-23(19)35-27-22(32-29(35)36)14-30-28-26(27)31-18-34(28)16-21-9-10-24(37-2)25(13-21)38-3/h4-10,13-14,18-19,23H,11-12,15-17H2,1-3H3,(H,32,36)/t19-,23+/m1/s1 |
| InChIKey | QPSWCVVVSBUWSG-XXBNENTESA-N |
| XLogP | 4.22 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |