C20H22N6O — CID 59292034
12-[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]-3,5,7,10,12-pentazatricyclo[7.3.0.02,6]dodeca-1,4,6,8-tetraen-11-one (PubChem CID 59292034) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is 12-[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]-3,5,7,10,12-pentazatricyclo[7.3.0.02,6]dodeca-1,4,6,8-tetraen-11-one.
| Compound Name | 12-[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]-3,5,7,10,12-pentazatricyclo[7.3.0.02,6]dodeca-1,4,6,8-tetraen-11-one |
|---|---|
| PubChem CID | 59292034 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 12-[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]-3,5,7,10,12-pentazatricyclo[7.3.0.02,6]dodeca-1,4,6,8-tetraen-11-one |
| SMILES | C[C@@H]1CCN(Cc2ccccc2)C[C@@H]1n1c(=O)[nH]c2cnc3nc[nH]c3c21 |
| InChI | InChI=1S/C20H22N6O/c1-13-7-8-25(10-14-5-3-2-4-6-14)11-16(13)26-18-15(24-20(26)27)9-21-19-17(18)22-12-23-19/h2-6,9,12-13,16H,7-8,10-11H2,1H3,(H,24,27)(H,21,22,23)/t13-,16+/m1/s1 |
| InChIKey | QISUELYHLRCKTK-CJNGLKHVSA-N |
| XLogP | 2.68 |
| TPSA | 82.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |