C27H27N5O2S — CID 67345112
4-(benzenesulfonyl)-3-(1-benzyl-3-methylpiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene (PubChem CID 67345112) has the molecular formula C27H27N5O2S and a molecular weight of 485.61 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-3-(1-benzyl-3-methylpiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene.
| Compound Name | 4-(benzenesulfonyl)-3-(1-benzyl-3-methylpiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
|---|---|
| PubChem CID | 67345112 |
| Molecular Formula | C27H27N5O2S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | 4-(benzenesulfonyl)-3-(1-benzyl-3-methylpiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
| SMILES | CC1CN(Cc2ccccc2)CCC1n1c(S(=O)(=O)c2ccccc2)nc2cnc3[nH]ccc3c21 |
| InChI | InChI=1S/C27H27N5O2S/c1-19-17-31(18-20-8-4-2-5-9-20)15-13-24(19)32-25-22-12-14-28-26(22)29-16-23(25)30-27(32)35(33,34)21-10-6-3-7-11-21/h2-12,14,16,19,24H,13,15,17-18H2,1H3,(H,28,29) |
| InChIKey | KZCWLMLRQPVWMN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |