C22H25N5O4S2 — CID 67323755
N-[4-[4-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]-N-methylmethanesulfonamide (PubChem CID 67323755) has the molecular formula C22H25N5O4S2 and a molecular weight of 487.61 g/mol. Its IUPAC name is N-[4-[4-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]-N-methylmethanesulfonamide.
| Compound Name | N-[4-[4-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 67323755 |
| Molecular Formula | C22H25N5O4S2 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | N-[4-[4-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]-N-methylmethanesulfonamide |
| SMILES | CN(C1CCC(n2c(S(=O)(=O)c3ccccc3)nc3cnc4[nH]ccc4c32)CC1)S(C)(=O)=O |
| InChI | InChI=1S/C22H25N5O4S2/c1-26(32(2,28)29)15-8-10-16(11-9-15)27-20-18-12-13-23-21(18)24-14-19(20)25-22(27)33(30,31)17-6-4-3-5-7-17/h3-7,12-16H,8-11H2,1-2H3,(H,23,24) |
| InChIKey | GBIDXOKZVNQCMR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 118.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |