C29H27N5O2S — CID 135142447
2-[4-[4-[4-(4-methylsulfonylphenyl)phenyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]acetonitrile (PubChem CID 135142447) has the molecular formula C29H27N5O2S and a molecular weight of 509.64 g/mol. Its IUPAC name is 2-[4-[4-[4-(4-methylsulfonylphenyl)phenyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]acetonitrile.
| Compound Name | 2-[4-[4-[4-(4-methylsulfonylphenyl)phenyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]acetonitrile |
|---|---|
| PubChem CID | 135142447 |
| Molecular Formula | C29H27N5O2S |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | 2-[4-[4-[4-(4-methylsulfonylphenyl)phenyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]acetonitrile |
| SMILES | CS(=O)(=O)c1ccc(-c2ccc(-c3nc4cnc5[nH]ccc5c4n3C3CCC(CC#N)CC3)cc2)cc1 |
| InChI | InChI=1S/C29H27N5O2S/c1-37(35,36)24-12-8-21(9-13-24)20-4-6-22(7-5-20)29-33-26-18-32-28-25(15-17-31-28)27(26)34(29)23-10-2-19(3-11-23)14-16-30/h4-9,12-13,15,17-19,23H,2-3,10-11,14H2,1H3,(H,31,32) |
| InChIKey | QCVRBWJVIKUJFH-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |