C17H17N9 — CID 137297629
2-[4-[4-(2H-tetrazol-5-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]acetonitrile (PubChem CID 137297629) has the molecular formula C17H17N9 and a molecular weight of 347.39 g/mol. Its IUPAC name is 2-[4-[4-(2H-tetrazol-5-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]acetonitrile.
| Compound Name | 2-[4-[4-(2H-tetrazol-5-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]acetonitrile |
|---|---|
| PubChem CID | 137297629 |
| Molecular Formula | C17H17N9 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 2-[4-[4-(2H-tetrazol-5-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]acetonitrile |
| SMILES | N#CCC1CCC(n2c(-c3nn[nH]n3)nc3cnc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C17H17N9/c18-7-5-10-1-3-11(4-2-10)26-14-12-6-8-19-15(12)20-9-13(14)21-17(26)16-22-24-25-23-16/h6,8-11H,1-5H2,(H,19,20)(H,22,23,24,25) |
| InChIKey | PFTOGSFYRLAHBJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 124.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |