C28H35N7O — CID 135143030
N'-[[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methoxy]adamantane-1-carboximidamide (PubChem CID 135143030) has the molecular formula C28H35N7O and a molecular weight of 485.64 g/mol. Its IUPAC name is N'-[[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methoxy]adamantane-1-carboximidamide.
| Compound Name | N'-[[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methoxy]adamantane-1-carboximidamide |
|---|---|
| PubChem CID | 135143030 |
| Molecular Formula | C28H35N7O |
| Molecular Weight | 485.64 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | N'-[[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methoxy]adamantane-1-carboximidamide |
| SMILES | N#CCC1CCC(n2c(CO/N=C(\N)C34CC5CC(CC(C5)C3)C4)nc3cnc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C28H35N7O/c29-7-5-17-1-3-21(4-2-17)35-24(33-23-15-32-26-22(25(23)35)6-8-31-26)16-36-34-27(30)28-12-18-9-19(13-28)11-20(10-18)14-28/h6,8,15,17-21H,1-5,9-14,16H2,(H2,30,34)(H,31,32) |
| InChIKey | LQGHOWBFKUTBEI-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 117.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.64 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|