C19H24N6O2S — CID 163926356
N-[[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]ethanesulfonamide (PubChem CID 163926356) has the molecular formula C19H24N6O2S and a molecular weight of 400.51 g/mol. Its IUPAC name is N-[[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]ethanesulfonamide.
| Compound Name | N-[[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 163926356 |
| Molecular Formula | C19H24N6O2S |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | N-[[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCc1nc2cnc3[nH]ccc3c2n1C1CCC(CC#N)CC1 |
| InChI | InChI=1S/C19H24N6O2S/c1-2-28(26,27)23-12-17-24-16-11-22-19-15(8-10-21-19)18(16)25(17)14-5-3-13(4-6-14)7-9-20/h8,10-11,13-14,23H,2-7,12H2,1H3,(H,21,22) |
| InChIKey | REUPTNPBTXIYAC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 116.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |