C18H24N4O3S — CID 123897610
2-[3-[4-(methylsulfonylmethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol (PubChem CID 123897610) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is 2-[3-[4-(methylsulfonylmethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol.
| Compound Name | 2-[3-[4-(methylsulfonylmethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol |
|---|---|
| PubChem CID | 123897610 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 2-[3-[4-(methylsulfonylmethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol |
| SMILES | CS(=O)(=O)CC1CCC(n2c(CCO)nc3cnc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C18H24N4O3S/c1-26(24,25)11-12-2-4-13(5-3-12)22-16(7-9-23)21-15-10-20-18-14(17(15)22)6-8-19-18/h6,8,10,12-13,23H,2-5,7,9,11H2,1H3,(H,19,20) |
| InChIKey | BKDIQSKIZLTGRT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |