C16H19N5O2 — CID 123475758
[4-(4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexyl]carbamic acid (PubChem CID 123475758) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is [4-(4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexyl]carbamic acid.
| Compound Name | [4-(4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 123475758 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | [4-(4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexyl]carbamic acid |
| SMILES | Cc1nc2cnc3[nH]ccc3c2n1C1CCC(NC(=O)O)CC1 |
| InChI | InChI=1S/C16H19N5O2/c1-9-19-13-8-18-15-12(6-7-17-15)14(13)21(9)11-4-2-10(3-5-11)20-16(22)23/h6-8,10-11,20H,2-5H2,1H3,(H,17,18)(H,22,23) |
| InChIKey | PTUVMLBZJJYZTL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |