C17H19N5O2 — CID 57406279
N-[4-(12-oxo-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8,10-pentaen-13-yl)cyclohexyl]acetamide (PubChem CID 57406279) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is N-[4-(12-oxo-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8,10-pentaen-13-yl)cyclohexyl]acetamide.
| Compound Name | N-[4-(12-oxo-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8,10-pentaen-13-yl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 57406279 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | N-[4-(12-oxo-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8,10-pentaen-13-yl)cyclohexyl]acetamide |
| SMILES | CC(=O)NC1CCC(n2c(=O)cnc3cnc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C17H19N5O2/c1-10(23)21-11-2-4-12(5-3-11)22-15(24)9-19-14-8-20-17-13(16(14)22)6-7-18-17/h6-9,11-12H,2-5H2,1H3,(H,18,20)(H,21,23) |
| InChIKey | NQEFNPGJKMZGPB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |