C21H23N5O2S — CID 67343208
4-[4-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]-N-methylcyclohexan-1-amine (PubChem CID 67343208) has the molecular formula C21H23N5O2S and a molecular weight of 409.52 g/mol. Its IUPAC name is 4-[4-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]-N-methylcyclohexan-1-amine.
| Compound Name | 4-[4-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]-N-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 67343208 |
| Molecular Formula | C21H23N5O2S |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 4-[4-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]-N-methylcyclohexan-1-amine |
| SMILES | CNC1CCC(n2c(S(=O)(=O)c3ccccc3)nc3cnc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C21H23N5O2S/c1-22-14-7-9-15(10-8-14)26-19-17-11-12-23-20(17)24-13-18(19)25-21(26)29(27,28)16-5-3-2-4-6-16/h2-6,11-15,22H,7-10H2,1H3,(H,23,24) |
| InChIKey | HTSGTAIPDUIXKZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |