C18H25N5O3S — CID 118408696
1-[4-[4-(methoxymethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]-N-methylmethanesulfonamide (PubChem CID 118408696) has the molecular formula C18H25N5O3S and a molecular weight of 391.50 g/mol. Its IUPAC name is 1-[4-[4-(methoxymethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]-N-methylmethanesulfonamide.
| Compound Name | 1-[4-[4-(methoxymethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 118408696 |
| Molecular Formula | C18H25N5O3S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 1-[4-[4-(methoxymethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]-N-methylmethanesulfonamide |
| SMILES | CNS(=O)(=O)CC1CCC(n2c(COC)nc3cnc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C18H25N5O3S/c1-19-27(24,25)11-12-3-5-13(6-4-12)23-16(10-26-2)22-15-9-21-18-14(17(15)23)7-8-20-18/h7-9,12-13,19H,3-6,10-11H2,1-2H3,(H,20,21) |
| InChIKey | PQYNGOOUEGPKGA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |