C21H27N7O — CID 175972297
N'-[[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methoxy]-2-methylpropanimidamide (PubChem CID 175972297) has the molecular formula C21H27N7O and a molecular weight of 393.50 g/mol. Its IUPAC name is N'-[[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methoxy]-2-methylpropanimidamide.
| Compound Name | N'-[[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methoxy]-2-methylpropanimidamide |
|---|---|
| PubChem CID | 175972297 |
| Molecular Formula | C21H27N7O |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | N'-[[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methoxy]-2-methylpropanimidamide |
| SMILES | CC(C)C(N)=NOCc1nc2cnc3[nH]ccc3c2n1C1CCC(CC#N)CC1 |
| InChI | InChI=1S/C21H27N7O/c1-13(2)20(23)27-29-12-18-26-17-11-25-21-16(8-10-24-21)19(17)28(18)15-5-3-14(4-6-15)7-9-22/h8,10-11,13-15H,3-7,12H2,1-2H3,(H2,23,27)(H,24,25) |
| InChIKey | OXLBSESIFRCVKM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 117.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|