C23H24N8O — CID 135142637
2-[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-N-(pyrimidin-4-ylmethyl)acetamide (PubChem CID 135142637) has the molecular formula C23H24N8O and a molecular weight of 428.50 g/mol. Its IUPAC name is 2-[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-N-(pyrimidin-4-ylmethyl)acetamide.
| Compound Name | 2-[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-N-(pyrimidin-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 135142637 |
| Molecular Formula | C23H24N8O |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 2-[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-N-(pyrimidin-4-ylmethyl)acetamide |
| SMILES | N#CCC1CCC(n2c(CC(=O)NCc3ccncn3)nc3cnc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C23H24N8O/c24-8-5-15-1-3-17(4-2-15)31-20(11-21(32)27-12-16-6-9-25-14-29-16)30-19-13-28-23-18(22(19)31)7-10-26-23/h6-7,9-10,13-15,17H,1-5,11-12H2,(H,26,28)(H,27,32) |
| InChIKey | FBMPIPDDIOMXIM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 125.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |