C22H28N6O2 — CID 167174839
2-[3-[[4-(cyanomethyl)cyclohexyl]methyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 167174839) has the molecular formula C22H28N6O2 and a molecular weight of 408.51 g/mol. Its IUPAC name is 2-[3-[[4-(cyanomethyl)cyclohexyl]methyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[3-[[4-(cyanomethyl)cyclohexyl]methyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 167174839 |
| Molecular Formula | C22H28N6O2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 2-[3-[[4-(cyanomethyl)cyclohexyl]methyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)Cc1nc2cnc3[nH]ccc3c2n1CC1CCC(CC#N)CC1 |
| InChI | InChI=1S/C22H28N6O2/c1-30-11-10-24-20(29)12-19-27-18-13-26-22-17(7-9-25-22)21(18)28(19)14-16-4-2-15(3-5-16)6-8-23/h7,9,13,15-16H,2-6,10-12,14H2,1H3,(H,24,29)(H,25,26) |
| InChIKey | VLPDBWVNZSLEPK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 108.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|