C26H28N6O2 — CID 167174973
2-[3-[[4-(cyanomethyl)cyclohexyl]methyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-N-[4-(hydroxymethyl)phenyl]acetamide (PubChem CID 167174973) has the molecular formula C26H28N6O2 and a molecular weight of 456.55 g/mol. Its IUPAC name is 2-[3-[[4-(cyanomethyl)cyclohexyl]methyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-N-[4-(hydroxymethyl)phenyl]acetamide.
| Compound Name | 2-[3-[[4-(cyanomethyl)cyclohexyl]methyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-N-[4-(hydroxymethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 167174973 |
| Molecular Formula | C26H28N6O2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 2-[3-[[4-(cyanomethyl)cyclohexyl]methyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-N-[4-(hydroxymethyl)phenyl]acetamide |
| SMILES | N#CCC1CCC(Cn2c(CC(=O)Nc3ccc(CO)cc3)nc3cnc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C26H28N6O2/c27-11-9-17-1-3-18(4-2-17)15-32-23(13-24(34)30-20-7-5-19(16-33)6-8-20)31-22-14-29-26-21(25(22)32)10-12-28-26/h5-8,10,12,14,17-18,33H,1-4,9,13,15-16H2,(H,28,29)(H,30,34) |
| InChIKey | WZCVFDNBPNOKCO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 119.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |