C26H26N6O — CID 135125413
2-[3-[4-(cyanomethyl)-1-bicyclo[2.2.2]octanyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-N-phenylacetamide (PubChem CID 135125413) has the molecular formula C26H26N6O and a molecular weight of 438.54 g/mol. Its IUPAC name is 2-[3-[4-(cyanomethyl)-1-bicyclo[2.2.2]octanyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-N-phenylacetamide.
| Compound Name | 2-[3-[4-(cyanomethyl)-1-bicyclo[2.2.2]octanyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 135125413 |
| Molecular Formula | C26H26N6O |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 2-[3-[4-(cyanomethyl)-1-bicyclo[2.2.2]octanyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-N-phenylacetamide |
| SMILES | N#CCC12CCC(n3c(CC(=O)Nc4ccccc4)nc4cnc5[nH]ccc5c43)(CC1)CC2 |
| InChI | InChI=1S/C26H26N6O/c27-14-13-25-7-10-26(11-8-25,12-9-25)32-21(16-22(33)30-18-4-2-1-3-5-18)31-20-17-29-24-19(23(20)32)6-15-28-24/h1-6,15,17H,7-13,16H2,(H,28,29)(H,30,33) |
| InChIKey | DHPKQSLHIJVITH-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 99.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |