C21H28N6O — CID 135142932
2-(3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl)-1-(4-piperidin-1-ylpiperidin-1-yl)ethanone (PubChem CID 135142932) has the molecular formula C21H28N6O and a molecular weight of 380.50 g/mol. Its IUPAC name is 2-(3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl)-1-(4-piperidin-1-ylpiperidin-1-yl)ethanone.
| Compound Name | 2-(3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl)-1-(4-piperidin-1-ylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 135142932 |
| Molecular Formula | C21H28N6O |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 2-(3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl)-1-(4-piperidin-1-ylpiperidin-1-yl)ethanone |
| SMILES | Cn1c(CC(=O)N2CCC(N3CCCCC3)CC2)nc2cnc3[nH]ccc3c21 |
| InChI | InChI=1S/C21H28N6O/c1-25-18(24-17-14-23-21-16(20(17)25)5-8-22-21)13-19(28)27-11-6-15(7-12-27)26-9-3-2-4-10-26/h5,8,14-15H,2-4,6-7,9-13H2,1H3,(H,22,23) |
| InChIKey | FJOALFVBDMEQNJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 70.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |