C23H30N6O2 — CID 146213270
2-[3-(4-methanimidoylcyclohexyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-1-(4-methoxypiperidin-1-yl)ethanone (PubChem CID 146213270) has the molecular formula C23H30N6O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-[3-(4-methanimidoylcyclohexyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-1-(4-methoxypiperidin-1-yl)ethanone.
| Compound Name | 2-[3-(4-methanimidoylcyclohexyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-1-(4-methoxypiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 146213270 |
| Molecular Formula | C23H30N6O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 2-[3-(4-methanimidoylcyclohexyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-1-(4-methoxypiperidin-1-yl)ethanone |
| SMILES | [H]/N=C/C1CCC(n2c(CC(=O)N3CCC(OC)CC3)nc3cnc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C23H30N6O2/c1-31-17-7-10-28(11-8-17)21(30)12-20-27-19-14-26-23-18(6-9-25-23)22(19)29(20)16-4-2-15(13-24)3-5-16/h6,9,13-17,24H,2-5,7-8,10-12H2,1H3,(H,25,26)/b24-13+ |
| InChIKey | JISVVAPXCIXJLI-ZMOGYAJESA-N |
| XLogP | 3.47 |
| TPSA | 99.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|