C20H25N5O3 — CID 58395407
cyclopropylmethyl N-[4-[4-(hydroxymethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]carbamate (PubChem CID 58395407) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is cyclopropylmethyl N-[4-[4-(hydroxymethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]carbamate.
| Compound Name | cyclopropylmethyl N-[4-[4-(hydroxymethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 58395407 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | cyclopropylmethyl N-[4-[4-(hydroxymethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]carbamate |
| SMILES | O=C(NC1CCC(n2c(CO)nc3cnc4[nH]ccc4c32)CC1)OCC1CC1 |
| InChI | InChI=1S/C20H25N5O3/c26-10-17-24-16-9-22-19-15(7-8-21-19)18(16)25(17)14-5-3-13(4-6-14)23-20(27)28-11-12-1-2-12/h7-9,12-14,26H,1-6,10-11H2,(H,21,22)(H,23,27) |
| InChIKey | RBYVOCHLIGTXTC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |