C15H17F2N5O — CID 71229550
[3-(3,3-difluoro-1-methylpiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methanol (PubChem CID 71229550) has the molecular formula C15H17F2N5O and a molecular weight of 321.33 g/mol. Its IUPAC name is [3-(3,3-difluoro-1-methylpiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methanol.
| Compound Name | [3-(3,3-difluoro-1-methylpiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methanol |
|---|---|
| PubChem CID | 71229550 |
| Molecular Formula | C15H17F2N5O |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | [3-(3,3-difluoro-1-methylpiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methanol |
| SMILES | CN1CCC(n2c(CO)nc3cnc4[nH]ccc4c32)C(F)(F)C1 |
| InChI | InChI=1S/C15H17F2N5O/c1-21-5-3-11(15(16,17)8-21)22-12(7-23)20-10-6-19-14-9(13(10)22)2-4-18-14/h2,4,6,11,23H,3,5,7-8H2,1H3,(H,18,19) |
| InChIKey | VCAJHXULBXRZOE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |