C17H22F2N6 — CID 67343421
2-[3-(1-ethyl-3,3-difluoropiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanamine (PubChem CID 67343421) has the molecular formula C17H22F2N6 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-[3-(1-ethyl-3,3-difluoropiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanamine.
| Compound Name | 2-[3-(1-ethyl-3,3-difluoropiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanamine |
|---|---|
| PubChem CID | 67343421 |
| Molecular Formula | C17H22F2N6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 2-[3-(1-ethyl-3,3-difluoropiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanamine |
| SMILES | CCN1CCC(n2c(CCN)nc3cnc4[nH]ccc4c32)C(F)(F)C1 |
| InChI | InChI=1S/C17H22F2N6/c1-2-24-8-5-13(17(18,19)10-24)25-14(3-6-20)23-12-9-22-16-11(15(12)25)4-7-21-16/h4,7,9,13H,2-3,5-6,8,10,20H2,1H3,(H,21,22) |
| InChIKey | OSKOKQXEXNBVNC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |