C23H27FN6O2S — CID 67343398
2-[10-(benzenesulfonyl)-3-[(3S,4R)-1-ethyl-3-fluoropiperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanamine (PubChem CID 67343398) has the molecular formula C23H27FN6O2S and a molecular weight of 470.57 g/mol. Its IUPAC name is 2-[10-(benzenesulfonyl)-3-[(3S,4R)-1-ethyl-3-fluoropiperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanamine.
| Compound Name | 2-[10-(benzenesulfonyl)-3-[(3S,4R)-1-ethyl-3-fluoropiperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanamine |
|---|---|
| PubChem CID | 67343398 |
| Molecular Formula | C23H27FN6O2S |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 2-[10-(benzenesulfonyl)-3-[(3S,4R)-1-ethyl-3-fluoropiperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanamine |
| SMILES | CCN1CC[C@@H](n2c(CCN)nc3cnc4c(ccn4S(=O)(=O)c4ccccc4)c32)[C@@H](F)C1 |
| InChI | InChI=1S/C23H27FN6O2S/c1-2-28-12-10-20(18(24)15-28)30-21(8-11-25)27-19-14-26-23-17(22(19)30)9-13-29(23)33(31,32)16-6-4-3-5-7-16/h3-7,9,13-14,18,20H,2,8,10-12,15,25H2,1H3/t18-,20+/m0/s1 |
| InChIKey | OZQYJMCJDJDEQI-AZUAARDMSA-N |
| XLogP | 2.73 |
| TPSA | 99.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |