C23H25N5O4S — CID 123189665
N-[4-[10-(benzenesulfonyl)-4-(2-hydroxyethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]formamide (PubChem CID 123189665) has the molecular formula C23H25N5O4S and a molecular weight of 467.55 g/mol. Its IUPAC name is N-[4-[10-(benzenesulfonyl)-4-(2-hydroxyethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]formamide.
| Compound Name | N-[4-[10-(benzenesulfonyl)-4-(2-hydroxyethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]formamide |
|---|---|
| PubChem CID | 123189665 |
| Molecular Formula | C23H25N5O4S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | N-[4-[10-(benzenesulfonyl)-4-(2-hydroxyethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]formamide |
| SMILES | O=CNC1CCC(n2c(CCO)nc3cnc4c(ccn4S(=O)(=O)c4ccccc4)c32)CC1 |
| InChI | InChI=1S/C23H25N5O4S/c29-13-11-21-26-20-14-24-23-19(10-12-27(23)33(31,32)18-4-2-1-3-5-18)22(20)28(21)17-8-6-16(7-9-17)25-15-30/h1-5,10,12,14-17,29H,6-9,11,13H2,(H,25,30) |
| InChIKey | CDPUGWFEKFYLQT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|