C20H22N6O2S — CID 67324426
10-(benzenesulfonyl)-N-methyl-3-piperidin-4-yl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-amine (PubChem CID 67324426) has the molecular formula C20H22N6O2S and a molecular weight of 410.50 g/mol. Its IUPAC name is 10-(benzenesulfonyl)-N-methyl-3-piperidin-4-yl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-amine.
| Compound Name | 10-(benzenesulfonyl)-N-methyl-3-piperidin-4-yl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-amine |
|---|---|
| PubChem CID | 67324426 |
| Molecular Formula | C20H22N6O2S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 10-(benzenesulfonyl)-N-methyl-3-piperidin-4-yl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-amine |
| SMILES | CNc1nc2cnc3c(ccn3S(=O)(=O)c3ccccc3)c2n1C1CCNCC1 |
| InChI | InChI=1S/C20H22N6O2S/c1-21-20-24-17-13-23-19-16(18(17)26(20)14-7-10-22-11-8-14)9-12-25(19)29(27,28)15-5-3-2-4-6-15/h2-6,9,12-14,22H,7-8,10-11H2,1H3,(H,21,24) |
| InChIKey | LFIHTTHIXFKCHR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |