C25H29N5O4S — CID 67346946
tert-butyl N-[3-[10-(benzenesulfonyl)-4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclopentyl]carbamate (PubChem CID 67346946) has the molecular formula C25H29N5O4S and a molecular weight of 495.61 g/mol. Its IUPAC name is tert-butyl N-[3-[10-(benzenesulfonyl)-4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[3-[10-(benzenesulfonyl)-4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 67346946 |
| Molecular Formula | C25H29N5O4S |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | tert-butyl N-[3-[10-(benzenesulfonyl)-4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclopentyl]carbamate |
| SMILES | Cc1nc2cnc3c(ccn3S(=O)(=O)c3ccccc3)c2n1C1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C25H29N5O4S/c1-16-27-21-15-26-23-20(12-13-29(23)35(32,33)19-8-6-5-7-9-19)22(21)30(16)18-11-10-17(14-18)28-24(31)34-25(2,3)4/h5-9,12-13,15,17-18H,10-11,14H2,1-4H3,(H,28,31) |
| InChIKey | DVDZDCDLTAJYHK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |