C30H39N5O3SSi — CID 154065547
3-[(1R,3R)-3-[10-(benzenesulfonyl)-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclopentyl]propanenitrile (PubChem CID 154065547) has the molecular formula C30H39N5O3SSi and a molecular weight of 577.83 g/mol. Its IUPAC name is 3-[(1R,3R)-3-[10-(benzenesulfonyl)-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclopentyl]propanenitrile.
| Compound Name | 3-[(1R,3R)-3-[10-(benzenesulfonyl)-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclopentyl]propanenitrile |
|---|---|
| PubChem CID | 154065547 |
| Molecular Formula | C30H39N5O3SSi |
| Molecular Weight | 577.83 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | 3-[(1R,3R)-3-[10-(benzenesulfonyl)-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclopentyl]propanenitrile |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)c1nc2cnc3c(ccn3S(=O)(=O)c3ccccc3)c2n1[C@@H]1CC[C@H](CCC#N)C1 |
| InChI | InChI=1S/C30H39N5O3SSi/c1-21(38-40(5,6)30(2,3)4)28-33-26-20-32-29-25(16-18-34(29)39(36,37)24-12-8-7-9-13-24)27(26)35(28)23-15-14-22(19-23)11-10-17-31/h7-9,12-13,16,18,20-23H,10-11,14-15,19H2,1-6H3/t21-,22+,23-/m1/s1 |
| InChIKey | FGSOAEMDPGHKLF-XPWALMASSA-N |
| XLogP | 7.35 |
| TPSA | 102.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.83 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|