C29H40N4O4SSi — CID 67324401
[4-[10-(benzenesulfonyl)-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]methanol (PubChem CID 67324401) has the molecular formula C29H40N4O4SSi and a molecular weight of 568.82 g/mol. Its IUPAC name is [4-[10-(benzenesulfonyl)-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]methanol.
| Compound Name | [4-[10-(benzenesulfonyl)-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 67324401 |
| Molecular Formula | C29H40N4O4SSi |
| Molecular Weight | 568.82 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | [4-[10-(benzenesulfonyl)-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]methanol |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)c1nc2cnc3c(ccn3S(=O)(=O)c3ccccc3)c2n1C1CCC(CO)CC1 |
| InChI | InChI=1S/C29H40N4O4SSi/c1-20(37-39(5,6)29(2,3)4)27-31-25-18-30-28-24(26(25)33(27)22-14-12-21(19-34)13-15-22)16-17-32(28)38(35,36)23-10-8-7-9-11-23/h7-11,16-18,20-22,34H,12-15,19H2,1-6H3/t20-,21?,22?/m1/s1 |
| InChIKey | RUCQGLLLVOFCHW-ITAUSPCMSA-N |
| XLogP | 6.43 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.82 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|