C32H29N5O5S2 — CID 172515770
(1R)-1-[10-(benzenesulfonyl)-3-[1-(4-phenylphenyl)sulfonylpyrrolidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol (PubChem CID 172515770) has the molecular formula C32H29N5O5S2 and a molecular weight of 627.75 g/mol. Its IUPAC name is (1R)-1-[10-(benzenesulfonyl)-3-[1-(4-phenylphenyl)sulfonylpyrrolidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol.
| Compound Name | (1R)-1-[10-(benzenesulfonyl)-3-[1-(4-phenylphenyl)sulfonylpyrrolidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol |
|---|---|
| PubChem CID | 172515770 |
| Molecular Formula | C32H29N5O5S2 |
| Molecular Weight | 627.75 g/mol |
| Exact Mass | 627.16 |
| IUPAC Name | (1R)-1-[10-(benzenesulfonyl)-3-[1-(4-phenylphenyl)sulfonylpyrrolidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol |
| SMILES | C[C@@H](O)c1nc2cnc3c(ccn3S(=O)(=O)c3ccccc3)c2n1C1CCN(S(=O)(=O)c2ccc(-c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C32H29N5O5S2/c1-22(38)31-34-29-20-33-32-28(17-19-36(32)44(41,42)26-10-6-3-7-11-26)30(29)37(31)25-16-18-35(21-25)43(39,40)27-14-12-24(13-15-27)23-8-4-2-5-9-23/h2-15,17,19-20,22,25,38H,16,18,21H2,1H3/t22-,25?/m1/s1 |
| InChIKey | CDKIZJOSSSSLPI-UFUCKMQHSA-N |
| XLogP | 4.98 |
| TPSA | 127.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.75 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |